| 释义 |
- Introduction
- References
{{AFC submission|t||ts=20181201210644|u=Kotomtom02|ns=118|demo=}} Introduction Isobutylbenzene, C10H14[1], is an organic substance most known for its use in industrial manufacture of Ibuprofen. Isobutylbenzene is a respiratory irritant, flammable, and is colourless. . {{Chembox|||ImageFile=Isobutylbenzene 3D spacefill.png|ImageFile1=Iso-Butylbenzene.svg|ImageName=|ImageName1=|ImageSize=160|ImageSize1=160|Names=2-methylpropylbenzene|OtherNames=Isobutylbenzene|Section1={{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = FI94T26KGB
| InChI = InChI=1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
| PubChem = 10870
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 195882
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14/c1-9(2)8-10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KXUHSQYYJYAXGZ-UHFFFAOYSA-N
| CASNo = 538-93-2
| CASNo_Ref = {{cascite|correct|CAS}}
| EC_number = 208-706-2
| Beilstein = 1852218
| Gmelin = 261101
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 10410
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 43261
| UNNumber = 2709
| SMILES = CC(C)CC1=CC=CC=C1
| Properties_ref = [2]
| Formula = C10H14
| MolarMass = 134.222 g/mol
| Appearance = Colorless liquid
| Odor = Aromatic
| Density = 0.853 g/cm3, liquid
| Solubility =
| MeltingPtC = −51
| BoilingPtC =170
| pKa =
| Viscosity =
| RefractIndex = 1.486
| LogP =
| VaporPressure = 4.2 mmHg (37.7°C)
| Hazards_ref = [2]
| ExternalSDS = ICSC 0113
| EUClass = Irritant, Aspiration hazard
| GHSPictograms = {{GHS02}}{{GHS07}}{{GHS08}}
| GHSSignalWord = Danger
| HPhrases = {{H-phrases|226|304|315|319|335|336}}
| PPhrases = {{P-phrases|210|233|240|241|242|243|261|264|271|280|301+310|302+352|303+361+353|304+340|305+351+338|312|321|331|332+313|337+313|362|370+378|403+233|403+235|405|501}}
| NFPA-H =
| NFPA-F = 2
| NFPA-R =
| FlashPtC =
| AutoignitionPtC = 427.777778
| ExploLimits =
| IDLH =
| REL =
| PEL =
| LDLo =Chart on left[3][1] References Category:ChemistryCategory:Alkylbenzene |