| 释义 |
- References
{{Chembox
| ImageFile = Pentahydroxybenzene.svg
| ImageSize = 200px
| IUPACName = Benzene-1,2,3,4,5-pentol
| OtherNames = 1,2,3,4,5-Benzenepentol
| Section1 = {{Chembox Identifiers
| CASNo = 4270-96-6
| PubChem = 316180
| SMILES = C1=C(C(=C(C(=C1O)O)O)O)O
| StdInChI=1S/C6H6O5/c7-2-1-3(8)5(10)6(11)4(2)9/h1,7-11H
| StdInChIKey = RUFWIGMRKSSQJC-UHFFFAOYSA-N
| Section2 = {{Chembox Properties
| C=6 | H=6 | O=5
| Appearance = pinkish crystals
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}Pentahydroxybenzene (C6H6O5) is a chemical compound whose structure consists of a benzene ring with five hydroxy groups (–OH) as substituents. The substance forms white to pinkish crystals.[1] It decomposes at 264–269 °C.[1] References 1. ^1 {{cite journal | doi = 10.1021/je60040a041 | title = Esters of benzenepentol (pentahydroxybenzene) | journal = Journal of Chemical & Engineering Data | volume = 14 | pages = 118–119 | year = 1969 | last1 = Fatiadi | first1 = Alexander J. }}
1 : Phenols |