| 释义 |
{{Chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid =
| Name = Pyrosilicate anion
| IUPACName = disiloxane-1,1,1,3,3,3-hexolatato
| OtherNames = disilicate, diorthosilicate
| ImageFile = Silicate-double-tetrahedra-3D-balls.png
| ImageSize = 200px
| ImageName =
|Section1={{Chembox Identifiers
| InChI1 =
| InChIKey1 =
| CASNo_Ref = {{cascite|changed|CAS}}
| CASNo =
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII =
| PubChem =
| ChemSpiderID = 5257009
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| EINECS =
| UNNumber =
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI =
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/O7Si2/c1-8(2,3)7-9(4,5)6/q-6
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KUDCBYUNCUYIDU-UHFFFAOYSA-N
| SMILES = [O-][Si]([O-])([O-])O[Si]([O-])([O-])[O-]
}}
|Section2={{Chembox Properties
| MeltingPtC =
| Formula_Charge = −6
| O=7 | Si=2
| ConjugateAcid = Pyrosilicic acid
}}
|Section3=
}}A pyrosilicate is a type of chemical compound; either an ionic compound that contains the pyrosilicate anion {{chem|Si|2|O|7|6-}}, or an organic compound with the hexavalent ≡{{chem|O|3|Si}}-O//Moiety (chemistry)">group. The anion is also called disilicate[{{chem|FeO}}-{{chem|Si|O|2}} System". Chemistry of Materials, volume 29, issue 10, pages 4361–4366. {{doi|10.1021/acs.chemmater.7b00764}}
3. ^Viktor Renman, Mario Valvo, Cheuk-Wai Tai, and Cesar Pay Gómez (2017): "Manganese Pyrosilicates as Novel Positive Electrode Materials for Na-Ion Batteries". Uppsala University Publications, DIVA urn:nbn:se:uu:diva-334063
4. ^Viktor Renman (2017): "Structural and Electrochemical Relations in Electrode Materials for Rechargeable Batteries", Doctoral Thesis, Uppsala University, Department of Chemistry. ORCID: 0000-0001-8739-4054
5. ^Volker Kahlenberg, Thomas Langreiter, and Erik Arroyabe (2010): "{{chem|Na|6|Si|2|O|7}} – The Missing Structural Link among Alkali Pyrosilicates". Zeitschrift für anorganishe und allgemeine Chemie (Journal for Inorganic and General Chemistry), volume 636, issue 11, pages 1974-1979. {{doi|10.1002/zaac.201000120}}
6. ^1 2 Yu. I. Smolin and Yu. F. Shepelev (1970): "The crystal structures of the rare earth pyrosilicates". Acta Crystallographica Section B, volume B26, pages 484-492. {{doi|10.1107/S0567740870002698}}
7. ^1 Dias, H.W.; Glasser, F.P.; Gunwardane, R.P.; and Howie, R.A. (1990): "The crystal structure of δ-yttrium pyrosilicate, δ-{{chem|Y|2|Si|2|O|7}}". Zeitschrift fuer Kristallographie, volume 191, issues 1/2, pages 117-123; ISSN 0044-2968
8. ^1 2 Anan'eva, G.V.; Karapetyan, V.E.; Korovkin, A.M.; Merkulyaeva, T.I.; Peschanskaya, I.A.; Savinova, I.P.; and Feofilov, P.P. (1982): "Strukturnye kharakteristiki i fizicheskie svojstva kristallov diorto(piro)silikatov lantanoidov, ittriya i skandiya, vyrashchennykh metodom Chokhral'skogo" ("Structural characteristics and physical properties of diortho(pyro)silicate crystals of lanthanides yttrium and scandium grown by the Czochralski technique"). Izv. Akad. Nauk SSSR, Neorg. Mater (translated in Inorganic Materials, USA) volume 18, issue 3, pages 442-445. ISSN 0002-337X.
2 : Oxyanions|Sorosilicates |