请输入您要查询的百科知识:

 

词条 (+)-CPCA
释义

  1. Background

  2. Pharmacology

  3. Chemistry

     Routes of synthesis  Ester and amine modifications  3β-Substituted nocaine ligand design  Nocaine: sulfur appendage 

  4. DAT arylpiperidine CoMFA study

  5. Patents

     Neurosearch 

  6. See also

  7. References

{{redirect-distinguish|Nocaine|Norcocaine}}{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 445600638
| IUPAC_name = methyl (3R,4S)-4-(4-chlorophenyl)-1-methylpiperidine-3-carboxylate
| image = (+)-CPCA.svg
| width = 200
| tradename =
| routes_of_administration =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number =
| ATC_prefix = none
| PubChem = 10333222
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8508681
| C=14 | H=18 | Cl=1 | N=1 | O=2
| molecular_weight = 267.751 g/mol
| smiles = Clc1ccc(cc1)[C@@H]2[C@@H](C(=O)OC)CN(C)CC2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C14H18ClNO2/c1-16-8-7-12(13(9-16)14(17)18-2)10-3-5-11(15)6-4-10/h3-6,12-13H,7-9H2,1-2H3/t12-,13+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = GDFVYUDIAQQDTA-OLZOCXBDSA-N
}}

(+)-CPCA (nocaine, 3α-carbomethoxy-4β-(4-chlorophenyl)-N-methylpiperidine) is a stimulant drug similar in structure to pethidine (an opioid that possesses NDRI actions) and to RTI-31, but nocaine is lacking the two-carbon bridge of RTI-31's tropane skeleton [1][2] This compound was first developed as a substitute agent for cocaine.

Since this time a large number of substituted phenylpiperidine derivatives have been discovered, hybridizing the basic nocaine structure with that of other similar molecules such as methylphenidate, meperidine and modafinil to create a large family of derivatives with a range of activity profiles and potential applications. This is a significant field of research with much work ongoing, and dozens of novel compounds have been developed although none have yet come to market.

The nocaine family includes a diverse assortment of piperidine based cocaine mimics. The parent compound nocaine was developed in an attempt to develop a substitute drug for cocaine for the treatment of addiction, and was found to substitute for cocaine in animal models while having significantly less abuse potential itself.

Background

Although Kozikowski reported compound with chlorine in 1998, plain phenyl was reported earlier than this by Plati.

Although novel ways to produce these compound exist, background stems from arecoline chemistry. E.g. Paxil and femoxetine also from this arena of CNS chemicals. These serotonin based antidepressants, in case of Paxil N-normethyl also some acetylcholinergic according to texts.

Kozikowski made some phenylpiperidine based bridged/fused analogs of Paxil, but with differing choice of halogen in: {{US patent|6150376}}

This shows us the special relationship between the two compounds that they share & CNS chemistry in general.

Pharmacology

Like cocaine, (–)-cis-CPCA and (+)-CPCA bind to the dopamine transporter and inhibit dopamine uptake, stimulate motor activity in rodents and completely substitute for cocaine in discrimination tests. Pretreatment with (–)-cis-CPCA or (+)-CPCA enhances the cocaine discriminative stimulus in rats. However, there are a number of differences; the locomotor stimulant effects of the piperidine derivatives are much less than those induced by cocaine, and pretreating mice with (–)-cis-CPCA or (+)-CPCA does not increase cocaine induced convulsions, and actually reduced cocaine induced locomotor stimulation. The (–)-cis-CPCA isomer has similar reinforcing effects to cocaine as shown by fixed-ratio self-administration tests in rats, but (+)-CPCA has a flat dose-response curve, and similarly while (–)-cis-CPCA and cocaine had nearly identical break points in a "punished responding" (?) self-administration test, (+)-CPCA had a lower break point than either of the other drugs.

Monoamine Reuptake Activity (nM)
Compound[3H]NE[3H]5-HT[3H]DA
Cocaine119177275
(–)-cis-CPCA9839067
(+)-CPCA905900276

The generally lower efficacy of (+)-CPCA in locomotor and methamphetamine discrimination tests could result from the differential selectivity of the two isomers for the DAT relative to the SERT. That is, if serotonin receptor activation is requisite for maximal efficacy, the difference SERT affinity between (–)-cis-CPCA and (+)-CPCA might play a contributory role in accounting for the differences in the observed pharmacology. Catecholamine selective drugs, like TMP (methylphenidate), are reported to possess decent abuse potential though, so it is not easy to gauge why (+)-CPCA does not entice a strong self-administration propensity.

A possible explanation might be nocaine preferentially binds to the ↓ DAT, in which case it would be expected to behave somewhat differently from cocaine.[3] Some sort of cholinergic effect might also be aversive. For example, muscarinic activity of benztropine analogs is known to limit their reinforcing potential.[3] Ion-channel activity is another factor that can be used to explain certain differences in pharmacology.

It is possible that sigma receptor activity might also account for some of the differences between cocaine and these piperidine mimics (R. Matsumoto, et al. 2001,[4][5][6][7] (Ping and Teruo, 2003 rev).[8] Sigma receptors are not specific to cocaine, other psychostimulants like methylphenidate, methamphetamine (E. Nguyen, et al. 2005),[9] and phencyclidine are also linked to this neural target. An increased understanding of this receptor recently led to a novel AD being reported that is based around its pharmacology.[10]

In summary, (+)-CPCA has lower potency and efficacy than cocaine in increasing locomotor activity in rodents. (+)-CPCA only manages to produce partial methamphetamine-like discriminative stimulus effects, although it is fully cocaine-like in cocaine-trained animals. (+)-CPCA has lower reinforcing potential than cocaine as assessed by fixed and progressive ratio IV self-administration tests in rats, with its reinforcing effects confirmed by rhesus monkeys. Furthermore, (+)-CPCA dose dependently antagonizes cocaine-induced locomotion and potentiates the discriminative stimulus effects of a low dose of cocaine. (+)-CPCA, unlike cocaine, does not enhance cocaine-induced convulsions. These results suggest that (+)-CPCA completely mimics certain behavioral actions of cocaine, whereas acting like a weak partial agonist in others, including its ability to attenuate cocaine-induced increase in locomotion and to serve as a positive reinforcing agent in rodents. Thus, (+)-CPCA may have potential utility in the treatment of cocaine addiction, and also offer valuable pharmacological information, furthering our understanding of cocaine's mechanism of action, because it exhibits fundamental differences from other related DARI molecules.

Chemistry

Routes of synthesis

To make any of the phenyltropanes requires either a source of cocaine, or extensive and repeated separation of enantiomers due to the lack of enantioselective routes to the essential intermediate methylecgonidine and the large differences in potency between different structural isomers of the final product.[11]

Laboratory synthesis has been devised [12] but is hampered by the fact that in addition to the wanted isomer of anhydroecgonidine, they are also saddled with the unwanted enantiomer.

Ester and amine modifications

A series of novel N- and 3α-modified nocaine analogs were synthesized and tested for their SNDRI activity and behavioral properties in mice.[13]

The rational design of ligands with a predetermined potency at and selectivity for monoamine transporters is hindered by the lack of knowledge about the 3D structure of these targets. In cases where the 3D structure of the binding site in a target protein is not well defined, as is the case for the monoamine transporter proteins, one can perform ligand-based design to develop a pharmacophore. That is, by studying the conformational properties of a series of pharmacologically similar compounds, one can form hypotheses regarding the pharmacophore.[14] Most of the potent tropane-based inhibitors, inc. coca, are believed to have at least 3 major interactions with the transporter binding site: one ionic or H-bonding interaction at the basic nitrogen, one dipole-dipole or H-bonding interaction of the ester group, and an interaction of the aryl group with a lipophilic binding pocket. This model was successfully used for the design of a novel piperidine-based DAT inhibitor, that is economically affordable to manufacture.[15]

Although the in vivo metabolism of (+)-CPCA is also likely to involve N-demethylation, metabolism to the corresponding free acid, to give a compound inactive at all monoamine transporters, will probably be the predominant pathway in vivo. It was reasoned that metabolism via esterase action can be avoided by replacing the ester group with a bioisosteric group that is more stable to metabolic degradation. In previous studies, it was found that oxadiazole, although cocaine-like in activity, exhibits a significantly longer duration of action due to slower rate of metabolism. In general, relative to the corresponding N-methyl compounds, the norpiperidines exhibited an increased activity at the SERT/NET and only modest changes at the DAT.

Ki (nM)
RNEDA5HT
CO2Me252 → 7.9233 → 2798490 → 434
CH2OH198 → 69497 → 8361550 → 239
Oxadiazole256 → 34187 → 1895960 → 373

An interesting difference between cocaine, ester 1a, alcohol 2a, and norester 1b is that the latter two compounds are substantially longer acting than cocaine in locomotor activity tests in mice. Although prolonged action is anticipated from compounds like alcohol 2a and oxadiazole 3a which lack the 3α ester group and so are more difficult to metabolise, this is not expected for the norester 1b, because the 3α ester group should be just as easily hydrolysed as the ester group of cocaine and 1a. Another result of N-demethylation is an initial depressant action of 1b followed by delayed locomotor stimulation, which might be due to interaction with GABA receptors or mGlu5.[16]

3β-Substituted nocaine ligand design

In an earlier study, it was found that 3α-amido and bulky 3α-oxadiazoyl nocaine ligands, which possess greater stability relative to the ester functional group, and are therefore more attractive as potential therapies, are inactive. This result led to the hypothesis that the binding site of the DAT and NET in close proximity to the 3α-position of the piperidine ring is compact and cannot accommodate bulky, sterically occluded substituents, like the 3-substituted 1,2,4-oxadiazolyl groups. It was reasoned that introduction of a methylene spacer would confer improved monoamine transporter binding affinity upon the resultant molecules.[17]

R[3H]DA[3H]5-HT[3H]NE
CO2Me2338490252
CONMe2214018900569
CH2OAc599901235
CH2OCH2CH=CH26023120
CH2CO2Et79191101
CH2CONMe216199446
Heterocycle443252
CH2CH2CO2Me6825531
trans-CH=CHCO2Me53501272
Prn202286.5
(CH2)3OH162810564

One of the possible reasons that the C2–C3 compounds are more active than the C1 compounds is that the polar group present in the more flexible 3α-appendage of the C2–C3 ligands is able to avoid unfavorable interactions with the binding site in close proximity to the piperidine ring. For the same reason the appendage in the C2–C3 series may more closely, but not precisely, mimic the binding mode of the more active SS based ligands, and possibly even transfer over to tropane based compounds.

To better understand the difference between the C1 and the C2–C3 series, the compounds were energy minimized and flexibly superimposed on WIN-35,428. The resulting overlay shows that only the C2–C3 ligands are able to adopt a conformation in which the polar group of the 3α-substituent occupies the position proximal to that of the 2β-polar group in WIN35428.

Nocaine: sulfur appendage

Compound 16e

DAT arylpiperidine CoMFA study

(Hongbin Yuan, et al. 2004)[18]

A generally recognized pharmacophore model for cocaine and phenyltropanes comprises two electrostatic interactions of the basic nitrogen and the ester group of the C-2 substituent, and one hydrophobic interaction of the C-3 aryl group. This model has been disputed because of the finding that in certain compounds neither the basic N nor the ester group was necessary for high binding affinity and inhibition of MAR. Instead, a hydrophobic pocket was proposed to exist in the vicinity of the C-2 carbon. Carroll et al., however, provided further evidence for an electrostatic interaction at the C-2β-position in a later study.

Other models proposed for the DAT binding site include a linear fashion binding pocket for the 3β-substituted phenyltropane analogs,[19] and a prohibited conical region about 5.5–10 Å distant from the 3α-substituted piperidine ring.[20] Noticeably, high potency at the DAT of dimeric piperidine-based esters and amides suggested that the flexible linker combining the two piperidine units was able to adjust its orientation and to avoid unfavorable interactions with the binding site.[21] All these lines of evidence suggest that the DAT binding site is much more complicated than the proposed pharmacophore models.

In an attempt to uncover the details of the DAT binding site, a number of 3D-QSAR studies were performed. Several QSAR/CoMFA studies focused on phenyltropanes concluded that an increased negative electrostatic potential in the regions around the 3β-substituent of the tropane ring and the para-position of the phenyl ring favored high potency in inhibiting the MATs. Wright et al. studied the role of the 3β-substituent of tropanes in binding to the DAT and blocking DA re-uptake. Their CoMFA model indicated that the 3β-substituent binding site is barrel-shaped and hydrophobic interactions make a dominant contribution to the binding,[19] which is consistent with the studies of 3α-substituted tropane analogs reported by Newman et al. Newman and co-authors also studied N-substituted tropanes and concluded that the steric interaction of the N-substituent with the DAT is a principal factor for the binding affinity.

Patents

  • Kowski: {{US Patent|6,806,281}} {{Cite patent|WO|0020390}}
  • Ward Neil: {{Cite patent|WO|0232870}} {{Cite patent|WO|0129032}} {{Cite patent|WO|0117966}} {{US patent|6172233}}

See also:[22][23]

Neurosearch

{{US patent|6,376,673}} {{Patent|WO|2004039778}}

See also

  • List of cocaine analogues
  • N,O-Dimethyl-4-(2-naphthyl)piperidine-3-carboxylate[24]
  • JZ-IV-10 and other modafinil hybrids[25][26]
  • 4-Fluoropethidine and other pethidine (meperidine) analogues.[27]
  • NET selective.[28][29]
  • Computer.[18][30]

References

1. ^ 
2. ^{{Cite journal| last1 = Kozikowski | first1 = A.| last2 = Araldi | first2 = G.| last3 = Boja | first3 = J.| last4 = Meil | first4 = W.| last5 = Johnson | first5 = K.| last6 = Flippen-Anderson | first6 = J.| last7 = George | first7 = C.| last8 = Saiah | first8 = E.| title = Chemistry and pharmacology of the piperidine-based analogues of cocaine. Identification of potent DAT inhibitors lacking the tropane skeleton| journal = Journal of Medicinal Chemistry| volume = 41| issue = 11| pages = 1962–1969| year = 1998| pmid = 9599245 | doi = 10.1021/jm980028}}
3. ^{{Cite journal| last1 = Zou | first1 = M.| last2 = Cao | first2 = J.| last3 = Kopajtic | first3 = T.| last4 = Desai | first4 = R.| last5 = Katz | first5 = J.| last6 = Newman | first6 = A.| title = Structure-activity relationship studies on a novel series of (S)-2beta-substituted 3alpha-bis(4-fluoro- or 4-chlorophenyl)methoxytropane analogues for in vivo investigation| journal = Journal of Medicinal Chemistry| volume = 49| issue = 21| pages = 6391–6399| year = 2006| pmid = 17034144 | doi = 10.1021/jm060762q}}
4. ^{{Cite journal | pmid = 11684152 | year = 2001 | last1 = Matsumoto | first1 = R. R. | last2 = Hewett | last3 = Pouw | last4 = Bowen | last5 = Husbands | last6 = Cao | last7 = Hauck Newman | title = Rimcazole analogs attenuate the convulsive effects of cocaine: correlation with binding to sigma receptors rather than dopamine transporters | volume = 41 | issue = 7 | pages = 878–886 | journal = Neuropharmacology | doi = 10.1016/S0028-3908(01)00116-2 | first2 = K. L. | first3 = B. | first4 = W. D. | first5 = S. M. | first6 = J. J. | first7 = A.}}
5. ^{{Cite journal | pmid = 11426838 | year = 2001 | last1 = Matsumoto | first1 = R. R. | last2 = Mccracken | last3 = Friedman | last4 = Pouw | last5 = De Costa | last6 = Bowen | title = Conformationally restricted analogs of BD1008 and an antisense oligodeoxynucleotide targeting sigma1 receptors produce anti-cocaine effects in mice | volume = 419 | issue = 2–3 | pages = 163–174 | journal = European Journal of Pharmacology | doi = 10.1016/S0014-2999(01)00968-2 | first2 = K. A. | first3 = M. J. | first4 = B. | first5 = B. R. | first6 = W. D.}}
6. ^{{Cite journal | pmid = 12128006 | year = 2002 | last1 = Matsumoto | first1 = R. R. | last2 = Mccracken | last3 = Pouw | last4 = Zhang | last5 = Bowen | title = Involvement of sigma receptors in the behavioral effects of cocaine: evidence from novel ligands and antisense oligodeoxynucleotides | volume = 42 | issue = 8 | pages = 1043–1055 | journal = Neuropharmacology | doi = 10.1016/S0028-3908(02)00056-4 | first2 = K. A. | first3 = B. | first4 = Y. | first5 = W. D.}}
7. ^{{Cite journal | pmid = 12782179 | year = 2003 | last1 = Matsumoto | first1 = R. R. | last2 = Liu | last3 = Lerner | last4 = Howard | last5 = Brackett | title = Sigma receptors: potential medications development target for anti-cocaine agents | volume = 469 | issue = 1–3 | pages = 1–12 | journal = European Journal of Pharmacology | doi = 10.1016/S0014-2999(03)01723-0 | first2 = Y. | first3 = M. | first4 = E. W. | first5 = D. J.}}
8. ^{{Cite journal | pmid = 12871086 | year = 2003 | last1 = Su | first1 = T. P. | last2 = Hayashi | title = Understanding the molecular mechanism of sigma-1 receptors: towards a hypothesis that sigma-1 receptors are intracellular amplifiers for signal transduction | volume = 10 | issue = 20 | pages = 2073–2080 | journal = Current Medicinal Chemistry | doi = 10.2174/0929867033456783 | first2 = T. }}
9. ^{{Cite journal| last1 = Nguyen | first1 = E.| last2 = Mccracken | first2 = K.| last3 = Liu | first3 = Y.| last4 = Pouw | first4 = B.| last5 = Matsumoto | first5 = R.| title = Involvement of sigma (sigma) receptors in the acute actions of methamphetamine: receptor binding and behavioral studies| journal = Neuropharmacology| volume = 49| issue = 5| pages = 638–645| year = 2005| pmid = 15939443 | doi = 10.1016/j.neuropharm.2005.04.016}}
10. ^{{Cite journal| last1 = Wang | first1 = J.| last2 = Mack | first2 = A.| last3 = Coop | first3 = A.| last4 = Matsumoto | first4 = R.| title = Novel sigma (sigma) receptor agonists produce antidepressant-like effects in mice| journal = European Neuropsychopharmacology| volume = 17| issue = 11| pages = 708–716| year = 2007| pmid = 17376658 | doi = 10.1016/j.euroneuro.2007.02.007 | pmc=4041597}}
11. ^{{Cite journal | pmid = 4747968 | year = 1973 | last1 = Clarke | first1 = R. L. | last2 = Daum | last3 = Gambino | last4 = Aceto | last5 = Pearl | last6 = Levitt | last7 = Cumiskey | last8 = Bogado | title = Compounds affecting the central nervous system. 4. 3 Beta-phenyltropane-2-carboxylic esters and analogs | volume = 16 | issue = 11 | pages = 1260–1267 | journal = Journal of Medicinal Chemistry | doi = 10.1021/jm00269a600 | first2 = S. J. | first3 = A. J. | first4 = M. D. | first5 = J. | first6 = M. | first7 = W. R. | first8 = E. F.}}
12. ^US Patent 5736556
13. ^{{Cite journal | pmid = 12109901 | year = 2002 | last1 = Petukhov | first1 = P. A. | last2 = Zhang | last3 = Kozikowski | last4 = Wang | last5 = Ye | last6 = Johnson | last7 = Tella | title = SAR studies of piperidine-based analogues of cocaine. 4. Effect of N-modification and ester replacement | volume = 45 | issue = 15 | pages = 3161–3170 | journal = Journal of Medicinal Chemistry | doi = 10.1021/jm0200153 | first2 = J. | first3 = A. P. | first4 = C. Z. | first5 = Y. P. | first6 = K. M. | first7 = S. R.}}
14. ^{{Cite journal| last1 = Froimowitz | first1 = M.| last2 = Gu | first2 = Y.| last3 = Dakin | first3 = L.| last4 = Nagafuji | first4 = P.| last5 = Kelley | first5 = C.| last6 = Parrish | first6 = D.| last7 = Deschamps | first7 = J.| last8 = Janowsky | first8 = A.| title = Slow-onset, long-duration, alkyl analogues of methylphenidate with enhanced selectivity for the dopamine transporter| journal = Journal of Medicinal Chemistry| volume = 50| issue = 2| pages = 219–232| year = 2007| pmid = 17228864 | doi = 10.1021/jm0608614}}
15. ^{{Cite journal | doi = 10.1021/jm990516x | pmid = 10669562 | year = 2000 | last1 = Wang | first1 = S. | last2 = Sakamuri | last3 = Enyedy | last4 = Kozikowski | last5 = Deschaux | last6 = Bandyopadhyay | last7 = Tella | last8 = Zaman | last9 = Johnson| title = Discovery of a novel dopamine transporter inhibitor, 4-hydroxy-1-methyl-4-(4-methylphenyl)-3-piperidyl 4-methylphenyl ketone, as a potential cocaine antagonist through 3D-database pharmacophore searching. Molecular modeling, structure-activity relationships, and behavioral pharmacological studies | volume = 43 | issue = 3 | pages = 351–360 | journal = Journal of Medicinal Chemistry | first2 = S. | first3 = I. J. | first4 = A. P. | first5 = O. | first6 = B. C. | first7 = S. R. | first8 = W. A. | first9 = K. M.}}
16. ^{{Cite journal| last1 = Chiamulera | first1 = C.| last2 = Epping-Jordan | first2 = M.| last3 = Zocchi | first3 = A.| last4 = Marcon | first4 = C.| last5 = Cottiny | first5 = C.| last6 = Tacconi | first6 = S.| last7 = Corsi | first7 = M.| last8 = Orzi | first8 = F.| last9 = Conquet | first9 = F.| title = Reinforcing and locomotor stimulant effects of cocaine are absent in mGluR5 null mutant mice| journal = Nature Neuroscience| volume = 4| issue = 9| pages = 873–874| year = 2001| pmid = 11528416 | doi = 10.1038/nn0901-873}}
17. ^{{Cite journal| last1 = Petukhov | first1 = P.| last2 = Zhang | first2 = J.| last3 = Wang | first3 = C.| last4 = Ye | first4 = Y.| last5 = Johnson | first5 = K.| last6 = Kozikowski | first6 = A.| title = Synthesis, molecular modeling, and biological studies of novel piperidine-based analogues of cocaine: evidence of unfavorable interactions proximal to the 3alpha-position of the piperidine ring| journal = Journal of Medicinal Chemistry| volume = 47| issue = 12| pages = 3009–3018| year = 2004| pmid = 15163183 | doi = 10.1021/jm0303296}}
18. ^{{Cite journal| last1 = Yuan | first1 = H.| last2 = Kozikowski | first2 = A.| last3 = Petukhov | first3 = P.| title = CoMFA study of piperidine analogues of cocaine at the dopamine transporter: exploring the binding mode of the 3 alpha-substituent of the piperidine ring using pharmacophore-based flexible alignment| journal = Journal of Medicinal Chemistry| volume = 47| issue = 25| pages = 6137–6143| year = 2004| pmid = 15566285 | doi = 10.1021/jm049544s}}
19. ^{{Cite journal| last1 = Lieske | first1 = S.| last2 = Yang | first2 = B.| last3 = Eldefrawi | first3 = M.| last4 = MacKerell | first4 = J.| last5 = Wright | first5 = J.| title = (-)-3 beta-Substituted ecgonine methyl esters as inhibitors for cocaine binding and dopamine uptake| journal = Journal of Medicinal Chemistry| volume = 41| issue = 6| pages = 864–876| year = 1998| pmid = 9526561 | doi = 10.1021/jm970025h}}
20. ^{{Cite journal | pmid = 11514143 | year = 2001 | last1 = Petukhov | first1 = P. A. | last2 = Zhang | last3 = Johnson | last4 = Tella | last5 = Kozikowski | title = Sar studies of piperidine-based analogues of cocaine. Part 3: oxadiazoles | volume = 11 | issue = 16 | pages = 2079–2083 | journal = Bioorganic & Medicinal Chemistry Letters | doi = 10.1016/S0960-894X(01)00379-1 | first2 = M. | first3 = K. J. | first4 = S. R. | first5 = A. P.}}
21. ^{{Cite journal | pmid = 11334571 | year = 2001 | last1 = Tamiz | first1 = A. P. | last2 = Bandyopadhyay | last3 = Zhang | last4 = Flippen-Anderson | last5 = Zhang | last6 = Wang | last7 = Johnson | last8 = Tella | last9 = Kozikowski| title = Pharmacological and behavioral analysis of the effects of some bivalent ligand-based monoamine reuptake inhibitors | volume = 44 | issue = 10 | pages = 1615–1622 | journal = Journal of Medicinal Chemistry | doi = 10.1021/jm000552s | first2 = B. C. | first3 = J. | first4 = J. L. | first5 = M. | first6 = C. Z. | first7 = K. M. | first8 = S. | first9 = A. P.}}
22. ^{{Cite journal| displayauthors = | pmid = 10814199| year = 2000| last1 = Amat | first1 = Mercedes| last2 = Bosch | first2 = Joan| last3 = Hidalgo | first3 = José| last4 = Cantó | first4 = Margalida| last5 = Pérez | first5 = Maria| last6 = Llor | first6 = Núria| last7 = Molins | first7 = Elies | last8 = Miravitlles | first8 = Carles| last9 = Orozco | first9 = Modesto| last10 = Luque | first10 = Javier| title = Synthesis of enantiopure trans-3,4-disubstituted piperidines. An enantiodivergent synthesis of (+)- and (-)-paroxetine| volume = 65| issue = 10| pages = 3074–3084| journal = The Journal of Organic Chemistry| doi = 10.1021/jo991816p}}
23. ^{{Cite journal| last1 = Johnson | first1 = Timothy A.| last2 = Jang | first2 = Doo Ok| last3 = Slafer | first3 = Brian W.| last4 = Curtis | first4 = Michael D.| last5 = Beak | first5 = Peter| title = Asymmetric Carbon−Carbon Bond Formations in Conjugate Additions of Lithiated N-Boc Allylic and Benzylic Amines to Nitroalkenes: Enantioselective Synthesis of Substituted Piperidines, Pyrrolidines, and Pyrimidinones| journal = Journal of the American Chemical Society| volume = 124| pages = 11689–11698| year = 2002| doi = 10.1021/ja0271375| pmid = 12296735| issue = 39 }}
24. ^{{Cite journal| pmid = 10737754| year = 2000| last1 = Tamiz | first1 = A. P.| last2 = Zhang| last3 = Flippen-Anderson| last4 = Zhang| last5 = Johnson| last6 = Deschaux| last7 = Tella| last8 = Kozikowski| title = Further SAR studies of piperidine-based analogues of cocaine. 2. Potent dopamine and serotonin reuptake inhibitors| volume = 43| issue = 6| pages = 1215–1222| journal = Journal of Medicinal Chemistry| doi = 10.1021/jm9905561 | first2 = J. | first3 = J. L. | first4 = M. | first5 = K. M. | first6 = O. | first7 = S. | first8 = A. P.}}
25. ^{{Cite journal| last2 = He| first1 = J. | first2 = R.| last4 = Ye| last3 = Johnson| last5 = Kozikowski | first3 = K.| last1 = Zhou | first4 = Y. | first5 = A.| title = Piperidine-based nocaine/modafinil hybrid ligands as highly potent monoamine transporter inhibitors: efficient drug discovery by rational lead hybridization| journal = Journal of Medicinal Chemistry| volume = 47| issue = 24| pages = 5821–5824| year = 2004| pmid = 15537337| pmc = 1395211| doi = 10.1021/jm040117o}}
26. ^{{Cite journal| last2 = Kurome| first1 = R. | first2 = T.| last4 = Johnson| last3 = Giberson| last5 = Kozikowski | first3 = K.| last1 = He | first4 = K. | first5 = A.| title = Further structure-activity relationship studies of piperidine-based monoamine transporter inhibitors: effects of piperidine ring stereochemistry on potency. Identification of norepinephrine transporter selective ligands and broad-spectrum transporter inhibitors| journal = Journal of Medicinal Chemistry| volume = 48| issue = 25| pages = 7970–7979| year = 2005| pmid = 16335921 | doi = 10.1021/jm050694s}}
27. ^{{Cite journal| last1 = Lomenzo | first1 = S.| last2 = Rhoden | first2 = J.| last3 = Izenwasser | first3 = S.| last4 = Wade | first4 = D.| last5 = Kopajtic | first5 = T.| last6 = Katz | first6 = J.| last7 = Trudell | first7 = M.| title = Synthesis and biological evaluation of meperidine analogues at monoamine transporters| journal = Journal of Medicinal Chemistry| volume = 48| issue = 5| pages = 1336–1343| year = 2005| pmid = 15743177 | doi = 10.1021/jm0401614}}
28. ^{{Cite journal| display-authors = | last1 = Musachio | first1 = John L.| last2 = Hong | first2 = Jinsoo| last3 = Ichise | first3 = Masanori| last4 = Seneca | first4 = Nicholas| last5 = Brown | first5 = Amira K.| last6 = Liow | first6 = Jeih-San| last7 = Halldin | first7 = Christer| last8 = Innis | first8 = Robert B.| last9 = Pike | first9 = Victor W.| last10 = He | first10 = Rong| last11 = Zhou | first11 = Jia| last12 = Kozikowski | first12 = Alan P.| title = Development of new brain imaging agents based upon nocaine-modafinil hybrid monoamine transporter inhibitors| volume = 16| pages = 3101–3104| year = 2006 | doi = 10.1016/j.bmcl.2006.03.066| pmid = 16621532| issue = 12| journal = Bioorganic & Medicinal Chemistry Letters}}
29. ^{{Cite journal | pmid = 16871320 | year = 2004 | last1 = Zhou | first1 = J. | title = Norepinephrine transporter inhibitors and their therapeutic potential | volume = 29 | issue = 12 | pages = 1235–1244 | journal = Drugs of the future | doi = 10.1358/dof.2004.029.12.855246 | pmc = 1518795}}
30. ^{{Cite journal| last1 = Yuan | first1 = H.| last2 = Petukhov | first2 = P.| title = Improved 3D-QSAR CoMFA of the dopamine transporter blockers with multiple conformations using the genetic algorithm| journal = Bioorganic & Medicinal Chemistry Letters| volume = 16| issue = 24| pages = 6267–6272| year = 2006| pmid = 17027270 | doi = 10.1016/j.bmcl.2006.09.037}}
{{Stimulants}}{{Dopaminergics}}{{DEFAULTSORT:Cpca}}

4 : Stimulants|Chloroarenes|Piperidines|Carboxylate esters

随便看

 

开放百科全书收录14589846条英语、德语、日语等多语种百科知识,基本涵盖了大多数领域的百科知识,是一部内容自由、开放的电子版国际百科全书。

 

Copyright © 2023 OENC.NET All Rights Reserved
京ICP备2021023879号 更新时间:2024/9/23 13:18:54