“A-84,543”的意思、由来-开放百科全书

1. ^{{Cite journal| last1 = Abreo | first1 = M.| last2 = Lin | first2 = N.| last3 = Garvey | first3 = D.| last4 = Gunn | first4 = D.| last5 = Hettinger | first5 = A.| last6 = Wasicak | first6 = J.| last7 = Pavlik | first7 = P.| last8 = Martin | first8 = Y.| last9 = Donnelly-Roberts | first9 = D.| pages = 817–825| pmid = 8632405| last10 = Anderson | doi = 10.1021/jm9506884| volume = 39 | first10 = D. J.| year = 1996| last11 = Sullivan | first11 = J. P.| last12 = Williams | first12 = M.| last13 = Arneric | first13 = S. P.| last14 = Holladay | first14 = M. W.| title = Novel 3-Pyridyl ethers with subnanomolar affinity for central neuronal nicotinic acetylcholine receptors| issue = 4| journal = Journal of Medicinal Chemistry}}
2. ^¹{{Cite journal | pmid = 9871663 | year = 1998 | last1 = Lin | first1 = N. H. | last2 = Gunn | last3 = Li | last4 = He | last5 = Bai | last6 = Ryther | last7 = Kuntzweiler | last8 = Donnelly-Roberts | last9 = Anderson | title = Synthesis and structure-activity relationships of pyridine-modified analogs of 3-2-((S)-pyrrolidinyl)methoxypyridine, A-84543, a potent nicotinic acetylcholine receptor agonist | first13 = M. W. | last13 = Holladay | first12 = S. P. | last12 = Arneric | first11 = J. P. | volume = 8 | last11 = Sullivan | issue = 3 | pages = 249–254 | first10 = J. E. | journal = Bioorganic & Medicinal Chemistry Letters | doi = 10.1016/S0960-894X(98)00019-5 | first2 = D. E. | last10 = Campbell | first3 = Y. | first4 = Y. | first5 = H. | first6 = K. B. | first7 = T. | first8 = D. L. | first9 = D. J.}}
3. ^{{Cite journal| last1 = Wei | first1 = Z.| last2 = Xiao | first2 = Y.| last3 = Yuan | first3 = H.| last4 = Baydyuk | first4 = M.| last5 = Petukhov | first5 = P.| last6 = Musachio | first6 = J.| last7 = Kellar | first7 = K.| last8 = Kozikowski | first8 = A.| title = Novel pyridyl ring C5 substituted analogues of epibatidine and 3-(1-methyl-2(S)-pyrrolidinylmethoxy)pyridine (A-84543) as highly selective agents for neuronal nicotinic acetylcholine receptors containing beta2 subunits| journal = Journal of Medicinal Chemistry| volume = 48| issue = 6| pages = 1721–1724| year = 2005| pmid = 15771418 | doi = 10.1021/jm0492406}}
4. ^{{Cite journal| last1 = Carreras | first1 = J.| last2 = Avenoza | first2 = A.| last3 = Busto | first3 = J.| last4 = Peregrina | first4 = J.| title = Synthesis of azabicyclo2.2.nalkane systems as analogues of 3-1-methyl-2-(S)-pyrrolidinyl- methoxypyridine (A-84543)| journal = The Journal of Organic Chemistry| volume = 72| issue = 8| pages = 3112–3115| year = 2007| pmid = 17371077 | doi = 10.1021/jo0700732}}

词条	A-84,543
释义	References {{Drugbox \| Verifiedfields = changed \| Watchedfields = changed \| verifiedrevid = 477346372 \| IUPAC_name = 3-{[(2S)-1-Methyl-2-pyrrolidinyl]methoxy}pyridine \| image = A-84,543.svg \| width = 175 \| tradename = \| routes_of_administration = \| CAS_number_Ref = {{cascite\|changed\|??}} \| CAS_number = 161416-43-9 \| ATC_suffix = None \| DrugBank_Ref = {{drugbankcite\|correct\|drugbank}} \| ChEMBL_Ref = {{ebicite\|changed\|EBI}} \| ChEMBL = 84149 \| PubChem = 9794141 \| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}} \| ChemSpiderID = 7969908 \| smiles = CN1CCC[C@H]1COc2cccnc2 \| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}} \| StdInChI=1S/C11H16N2O/c1-13-7-3-4-10(13)9-14-11-5-2-6-12-8-11/h2,5-6,8,10H,3-4,7,9H2,1H3/t10-/m0/s1 \| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}} \| StdInChIKey = MVLJPWPLDPHKST-JTQLQIEISA-N \| C=11 \| H=16 \| N=2 \| O=1 \| molecular_weight = 192.257 }}A-84543 is a drug developed by Abbott, which acts as an agonist at neural nicotinic acetylcholine receptors with high selectivity for the α4β2 subtype. It is widely used in scientific research into the structure and function of this receptor subtype and has been the lead compound for the development of a large family of related derivatives.^[1]^[2]^[2]^[3]^[4] References 1. ^{{Cite journal\| last1 = Abreo \| first1 = M.\| last2 = Lin \| first2 = N.\| last3 = Garvey \| first3 = D.\| last4 = Gunn \| first4 = D.\| last5 = Hettinger \| first5 = A.\| last6 = Wasicak \| first6 = J.\| last7 = Pavlik \| first7 = P.\| last8 = Martin \| first8 = Y.\| last9 = Donnelly-Roberts \| first9 = D.\| pages = 817–825\| pmid = 8632405\| last10 = Anderson \| doi = 10.1021/jm9506884\| volume = 39 \| first10 = D. J.\| year = 1996\| last11 = Sullivan \| first11 = J. P.\| last12 = Williams \| first12 = M.\| last13 = Arneric \| first13 = S. P.\| last14 = Holladay \| first14 = M. W.\| title = Novel 3-Pyridyl ethers with subnanomolar affinity for central neuronal nicotinic acetylcholine receptors\| issue = 4\| journal = Journal of Medicinal Chemistry}} 2. ^¹{{Cite journal \| pmid = 9871663 \| year = 1998 \| last1 = Lin \| first1 = N. H. \| last2 = Gunn \| last3 = Li \| last4 = He \| last5 = Bai \| last6 = Ryther \| last7 = Kuntzweiler \| last8 = Donnelly-Roberts \| last9 = Anderson \| title = Synthesis and structure-activity relationships of pyridine-modified analogs of 3-2-((S)-pyrrolidinyl)methoxypyridine, A-84543, a potent nicotinic acetylcholine receptor agonist \| first13 = M. W. \| last13 = Holladay \| first12 = S. P. \| last12 = Arneric \| first11 = J. P. \| volume = 8 \| last11 = Sullivan \| issue = 3 \| pages = 249–254 \| first10 = J. E. \| journal = Bioorganic & Medicinal Chemistry Letters \| doi = 10.1016/S0960-894X(98)00019-5 \| first2 = D. E. \| last10 = Campbell \| first3 = Y. \| first4 = Y. \| first5 = H. \| first6 = K. B. \| first7 = T. \| first8 = D. L. \| first9 = D. J.}} 3. ^{{Cite journal\| last1 = Wei \| first1 = Z.\| last2 = Xiao \| first2 = Y.\| last3 = Yuan \| first3 = H.\| last4 = Baydyuk \| first4 = M.\| last5 = Petukhov \| first5 = P.\| last6 = Musachio \| first6 = J.\| last7 = Kellar \| first7 = K.\| last8 = Kozikowski \| first8 = A.\| title = Novel pyridyl ring C5 substituted analogues of epibatidine and 3-(1-methyl-2(S)-pyrrolidinylmethoxy)pyridine (A-84543) as highly selective agents for neuronal nicotinic acetylcholine receptors containing beta2 subunits\| journal = Journal of Medicinal Chemistry\| volume = 48\| issue = 6\| pages = 1721–1724\| year = 2005\| pmid = 15771418 \| doi = 10.1021/jm0492406}} 4. ^{{Cite journal\| last1 = Carreras \| first1 = J.\| last2 = Avenoza \| first2 = A.\| last3 = Busto \| first3 = J.\| last4 = Peregrina \| first4 = J.\| title = Synthesis of azabicyclo2.2.nalkane systems as analogues of 3-1-methyl-2-(S)-pyrrolidinyl- methoxypyridine (A-84543)\| journal = The Journal of Organic Chemistry\| volume = 72\| issue = 8\| pages = 3112–3115\| year = 2007\| pmid = 17371077 \| doi = 10.1021/jo0700732}} {{Stimulants}}{{Nicotinic acetylcholine receptor modulators}}{{nervous-system-drug-stub}} 5 : Nicotinic agonists\|Phenol ethers\|Pyridines\|Pyrrolidines\|Stimulants
随便看	South Italy South Iwo Jima South Jacksonville South Jacksonville Grammar School South Jakarta South Jamaica, Queens NY South Jason South Jason Island South Jasper Ranges South Jefferson, Oregon South Jeolla South Jeolla province South Jersey Banshees South Jersey Industries South Jersey/Philadelphia Shared Assets Area South Jersey Radio Association South Jersey Regional Airport South Jersey Transportation Authority South Johor Economic Region South Jordan South Junction, Manitoba South Junction, MB South Kannanur South Kansas and Oklahoma Railroad South Kearny, New Jersey

References