词条 | Dihydrogossypetin |
释义 |
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 423445550 | Name = Dihydrogossypetin | ImageFile = Dihydrogossypetin.svg | ImageSize = 250px | IUPACName = (2R,3R)-2-(3,4-dihydroxyphenyl)-3,5,7,8-tetrahydroxy-2,3-dihydrochromen-4-one | OtherNames = 2,3-Dihydrogossypetin 3′,4′,5,7,8-pentahydroxyflavanonol |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 489-35-0 | PubChem = 5460097 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4573761 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 16965 | InChI = 1/C15H12O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,13-14,16-20,22H/t13-,14+/m0/s1 | InChIKey = ZHPLPRUARZZBET-UONOGXRCBO | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C15H12O8/c16-6-2-1-5(3-7(6)17)14-13(22)12(21)10-8(18)4-9(19)11(20)15(10)23-14/h1-4,13-14,16-20,22H/t13-,14+/m0/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = ZHPLPRUARZZBET-UONOGXRCSA-N | SMILES = C1=CC(=C(C=C1C2C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)OC1=CC(=C(C=C1[C@@H]2C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O)O |Section2={{Chembox Properties | Formula = C15H12O8 | MolarMass = 320.25 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }}Dihydrogossypetin is a flavanonol, a type of flavonoid.[1] BiosynthesisThe enzyme Taxifolin 8-monooxygenase hydroxylates taxifolin using NADH, NADPH, H+, and O2 to produce 2,3-dihydrogossypetin, NAD+, NADP+, and H2O. |