“Febrifugine”的意思、由来-开放百科全书

Febrifugine has antimalarial properties and the synthetic halogenated derivative halofuginone is used in veterinary medicine as a coccidiostat. Other synthetic febrifugine derivatives have been used against malaria, cancer, fibrosis, and inflammatory disease.^[3]

References

1. ^{{cite journal | last1 = McLaughlin | first1 = N. P. | last2 = Evans | first2 = P. | title = Dihydroxylation of Vinyl Sulfones: Stereoselective Synthesis of (+)- and (−)-Febrifugine and Halofuginone | journal = The Journal of Organic Chemistry | year = 2010 | volume = 75 | issue = 2 | pages = 518–521 | pmid = 20000346 | doi = 10.1021/jo902396m }}
2. ^{{Cite journal | doi = 10.1021/jo990877k| pmid = 11674693| title = Catalytic Asymmetric Synthesis of Antimalarial Alkaloids Febrifugine and Isofebrifugine and Their Biological Activity| journal = The Journal of Organic Chemistry| volume = 64| issue = 18| pages = 6833| year = 1999| last1 = Kobayashi| first1 = Shū| last2 = Ueno| first2 = Masaharu| last3 = Suzuki| first3 = Ritsu| last4 = Ishitani| first4 = Haruro| last5 = Kim| first5 = Hye-Sook| last6 = Wataya| first6 = Yusuke}}
3. ^{{cite journal|last1=Keller|first1=Tracy L|last2=Zocco|first2=Davide|last3=Sundrud|first3=Mark S|last4=Hendrick|first4=Margaret|last5=Edenius|first5=Maja|last6=Yum|first6=Jinah|last7=Kim|first7=Yeon-Jin|last8=Lee|first8=Hak-Kyo|last9=Cortese|first9=Joseph F|last10=Wirth|first10=Dyann F|last11=Dignam|first11=John David|last12=Rao|first12=Anjana|last13=Yeo|first13=Chang-Yeol|last14=Mazitschek|first14=Ralph|last15=Whitman|first15=Malcolm|displayauthors=8|title=Halofuginone and other febrifugine derivatives inhibit prolyl-tRNA synthetase|journal=Nature Chemical Biology|year= 2012|volume=8|issue=3|pages=311–317|doi=10.1038/nchembio.790|pmid=22327401|pmc=3281520}}

2 : Quinazolinones|Piperidine alkaloids

词条	Febrifugine
释义	References {{Chembox \| Verifiedfields = changed \| Watchedfields = changed \| verifiedrevid = 441877885 \| ImageFile = Febrifugine.png \| ImageSize = 200px \| IUPACName = 3-{3-[(2R,3S)-3-Hydroxypiperidin-2-yl]-2-oxopropyl}quinazolin-4(3H)-one \| OtherNames = \|Section1={{Chembox Identifiers \| StdInChI_Ref = {{stdinchicite\|changed\|chemspider}} \| StdInChI =1S/C16H19N3O3/c20-11(8-14-15(21)6-3-7-17-14)9-19-10-18-13-5-2-1-4-12(13)16(19)22/h1-2,4-5,10,14-15,17,21H,3,6-9H2/t14-,15+/m1/s1 \| StdInChIKey_Ref = {{stdinchicite\|changed\|chemspider}} \| StdInChIKey = FWVHWDSCPKXMDB-CABCVRRESA-N \| CASNo_Ref = {{cascite\|correct\|??}} \| CASNo = 24159-07-7 \| PubChem = 9851692 \| ChemSpiderID_Ref = {{chemspidercite\|changed\|chemspider}} \| ChemSpiderID = 8027405 \| ChEMBL_Ref = {{ebicite\|correct\|EBI}} \| ChEMBL = 479432 \| SMILES = C1C[C@@H]([C@H](NC1)CC(=O)CN2C=NC3=CC=CC=C3C2=O)O \|Section2={{Chembox Properties \| C=16 \| H=19 \| N=3 \| O=3 \| Appearance = \| Density = \| MeltingPt = \| BoilingPt = \| Solubility = \|Section3={{Chembox Hazards \| MainHazards = \| FlashPt = \| AutoignitionPt = }}Febrifugine is a quinazolinone alkaloid first isolated from the Chinese herb Dichroa febrifuga, but also found in the garden plant Hydrangea.^[1] Laboratory synthesis of febrifugine determined that the originally reported stereochemistry was incorrect.^[2] Febrifugine has antimalarial properties and the synthetic halogenated derivative halofuginone is used in veterinary medicine as a coccidiostat. Other synthetic febrifugine derivatives have been used against malaria, cancer, fibrosis, and inflammatory disease.^[3] References 1. ^{{cite journal \| last1 = McLaughlin \| first1 = N. P. \| last2 = Evans \| first2 = P. \| title = Dihydroxylation of Vinyl Sulfones: Stereoselective Synthesis of (+)- and (−)-Febrifugine and Halofuginone \| journal = The Journal of Organic Chemistry \| year = 2010 \| volume = 75 \| issue = 2 \| pages = 518–521 \| pmid = 20000346 \| doi = 10.1021/jo902396m }} 2. ^{{Cite journal \| doi = 10.1021/jo990877k\| pmid = 11674693\| title = Catalytic Asymmetric Synthesis of Antimalarial Alkaloids Febrifugine and Isofebrifugine and Their Biological Activity\| journal = The Journal of Organic Chemistry\| volume = 64\| issue = 18\| pages = 6833\| year = 1999\| last1 = Kobayashi\| first1 = Shū\| last2 = Ueno\| first2 = Masaharu\| last3 = Suzuki\| first3 = Ritsu\| last4 = Ishitani\| first4 = Haruro\| last5 = Kim\| first5 = Hye-Sook\| last6 = Wataya\| first6 = Yusuke}} 3. ^{{cite journal\|last1=Keller\|first1=Tracy L\|last2=Zocco\|first2=Davide\|last3=Sundrud\|first3=Mark S\|last4=Hendrick\|first4=Margaret\|last5=Edenius\|first5=Maja\|last6=Yum\|first6=Jinah\|last7=Kim\|first7=Yeon-Jin\|last8=Lee\|first8=Hak-Kyo\|last9=Cortese\|first9=Joseph F\|last10=Wirth\|first10=Dyann F\|last11=Dignam\|first11=John David\|last12=Rao\|first12=Anjana\|last13=Yeo\|first13=Chang-Yeol\|last14=Mazitschek\|first14=Ralph\|last15=Whitman\|first15=Malcolm\|displayauthors=8\|title=Halofuginone and other febrifugine derivatives inhibit prolyl-tRNA synthetase\|journal=Nature Chemical Biology\|year= 2012\|volume=8\|issue=3\|pages=311–317\|doi=10.1038/nchembio.790\|pmid=22327401\|pmc=3281520}} 2 : Quinazolinones\|Piperidine alkaloids
随便看	8678 Bäl 8679 Tingstade 8679 Tingstäde 867 in poetry 867th Reconnaissance Squadron 867‒5309/Jenny 8680 Rone 8681 Burs 8682 Kraklingbo 8682 Kräklingbo 8683 Sjolander 8683 Sjölander 8684 Reichwein 8685 Faure 8685 Fauré 8686 Akenside 8687 Caussols 8688 Delaunay 868 (disambiguation) 868 in poetry 868 (number) 868th Bombardment Squadron 868th Tactical Missile Training Squadron 8690 Swindle 8691 Etsuko