| 词条 | Melacacidin |
| 释义 |
| Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 423447301 | Name = Melacacidin | ImageFile = Melacacidin.svg | ImageSize = 250px | IUPACName = (2R,3R,4R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,4,7,8-tetrol | OtherNames = |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 38081-16-2 | PubChem = 169996 | SMILES = Oc1ccc(cc1O)[C@H]3Oc2c(O)c(O)ccc2[C@@H](O)[C@H]3O | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 148659 | InChI = 1/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1 | InChIKey = JEUXGAUBSWADEA-MRVWCRGKBR | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C15H14O7/c16-8-3-1-6(5-10(8)18)14-13(21)11(19)7-2-4-9(17)12(20)15(7)22-14/h1-5,11,13-14,16-21H/t11-,13-,14-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = JEUXGAUBSWADEA-MRVWCRGKSA-N |Section2={{Chembox Properties | Formula = C15H14O7 | MolarMass = 306.26 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = |Section3={{Chembox Hazards | MainHazards= | FlashPt= | AutoignitionPt = }}Melacacidin is a chemical compound related to leucoanthocyanidins. It can be found in Acacia crassicarpa.[1] Melacacidin is a compound that can provoke contact allergy to Australian blackwood Acacia melanoxylon.[2] |